C36H42O6Si — CID 10555524
1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethanone (PubChem CID 10555524) has the molecular formula C36H42O6Si and a molecular weight of 598.81 g/mol. Its IUPAC name is 1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 10555524 |
| Molecular Formula | C36H42O6Si |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 1-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)c2cc(OC)c(OC)cc2CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C36H42O6Si/c1-36(2,3)43(28-14-10-8-11-15-28,29-16-12-9-13-17-29)42-21-20-27-24-34(40-6)35(41-7)25-30(27)31(37)22-26-18-19-32(38-4)33(23-26)39-5/h8-19,23-25H,20-22H2,1-7H3 |
| InChIKey | XTEUEFCMLOEWIF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|