C35H38O4Si — CID 11028031
tert-butyl-[2-[2-ethynyl-4,5-dimethoxy-3-(4-methoxyphenyl)phenyl]ethoxy]-diphenylsilane (PubChem CID 11028031) has the molecular formula C35H38O4Si and a molecular weight of 550.77 g/mol. Its IUPAC name is tert-butyl-[2-[2-ethynyl-4,5-dimethoxy-3-(4-methoxyphenyl)phenyl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[2-ethynyl-4,5-dimethoxy-3-(4-methoxyphenyl)phenyl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11028031 |
| Molecular Formula | C35H38O4Si |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | tert-butyl-[2-[2-ethynyl-4,5-dimethoxy-3-(4-methoxyphenyl)phenyl]ethoxy]-diphenylsilane |
| SMILES | C#Cc1c(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc(OC)c(OC)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C35H38O4Si/c1-8-31-27(25-32(37-6)34(38-7)33(31)26-19-21-28(36-5)22-20-26)23-24-39-40(35(2,3)4,29-15-11-9-12-16-29)30-17-13-10-14-18-30/h1,9-22,25H,23-24H2,2-7H3 |
| InChIKey | WFAVMUWNNUEXSE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|