C22H25BrOSSi — CID 156828780
2-(2-bromothiophen-3-yl)ethoxy-tert-butyl-diphenylsilane (PubChem CID 156828780) has the molecular formula C22H25BrOSSi and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-(2-bromothiophen-3-yl)ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-(2-bromothiophen-3-yl)ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 156828780 |
| Molecular Formula | C22H25BrOSSi |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-(2-bromothiophen-3-yl)ethoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCc1ccsc1Br)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25BrOSSi/c1-22(2,3)26(19-10-6-4-7-11-19,20-12-8-5-9-13-20)24-16-14-18-15-17-25-21(18)23/h4-13,15,17H,14,16H2,1-3H3 |
| InChIKey | WNZTXFYAWMXQOI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|