C21H25NOSSi — CID 160666543
2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophen-3-amine (PubChem CID 160666543) has the molecular formula C21H25NOSSi and a molecular weight of 367.59 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophen-3-amine.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophen-3-amine |
|---|---|
| PubChem CID | 160666543 |
| Molecular Formula | C21H25NOSSi |
| Molecular Weight | 367.59 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophen-3-amine |
| SMILES | CC(C)(C)[Si](OCc1sccc1N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NOSSi/c1-21(2,3)25(17-10-6-4-7-11-17,18-12-8-5-9-13-18)23-16-20-19(22)14-15-24-20/h4-15H,16,22H2,1-3H3 |
| InChIKey | XRTIJKMZEUMKPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|