C23H31NOSSiSn — CID 58641700
tert-butyl-diphenyl-[(5-trimethylstannyl-1,3-thiazol-2-yl)methoxy]silane (PubChem CID 58641700) has the molecular formula C23H31NOSSiSn and a molecular weight of 516.37 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(5-trimethylstannyl-1,3-thiazol-2-yl)methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(5-trimethylstannyl-1,3-thiazol-2-yl)methoxy]silane |
|---|---|
| PubChem CID | 58641700 |
| Molecular Formula | C23H31NOSSiSn |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | tert-butyl-diphenyl-[(5-trimethylstannyl-1,3-thiazol-2-yl)methoxy]silane |
| SMILES | CC(C)(C)[Si](OCc1ncc([Sn](C)(C)C)s1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22NOSSi.3CH3.Sn/c1-20(2,3)24(17-10-6-4-7-11-17,18-12-8-5-9-13-18)22-16-19-21-14-15-23-19;;;;/h4-14H,16H2,1-3H3;3*1H3; |
| InChIKey | ZDDCSHFBZVMAEE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|