C21H25NO3S2Si — CID 69018519
2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophene-3-sulfonamide (PubChem CID 69018519) has the molecular formula C21H25NO3S2Si and a molecular weight of 431.66 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophene-3-sulfonamide.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 69018519 |
| Molecular Formula | C21H25NO3S2Si |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]thiophene-3-sulfonamide |
| SMILES | CC(C)(C)[Si](OCc1sccc1S(N)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3S2Si/c1-21(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)25-16-19-20(14-15-26-19)27(22,23)24/h4-15H,16H2,1-3H3,(H2,22,23,24) |
| InChIKey | MUWZWZSKRAPGMT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|