C29H33F3O6SSi — CID 10627315
[4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)but-2-enyl]-2-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 10627315) has the molecular formula C29H33F3O6SSi and a molecular weight of 594.72 g/mol. Its IUPAC name is [4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)but-2-enyl]-2-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)but-2-enyl]-2-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10627315 |
| Molecular Formula | C29H33F3O6SSi |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | [4-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)but-2-enyl]-2-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(C/C(=C/CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CO)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C29H33F3O6SSi/c1-28(2,3)40(24-11-7-5-8-12-24,25-13-9-6-10-14-25)37-18-17-23(21-33)19-22-15-16-26(27(20-22)36-4)38-39(34,35)29(30,31)32/h5-17,20,33H,18-19,21H2,1-4H3/b23-17- |
| InChIKey | HEWOUZLNNFQWJW-QJOMJCCJSA-N |
| XLogP | 4.96 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|