C41H43F3O6SSi2 — CID 135010974
[3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(2-oxoethyl)phenyl] trifluoromethanesulfonate (PubChem CID 135010974) has the molecular formula C41H43F3O6SSi2 and a molecular weight of 777.02 g/mol. Its IUPAC name is [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(2-oxoethyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(2-oxoethyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135010974 |
| Molecular Formula | C41H43F3O6SSi2 |
| Molecular Weight | 777.02 g/mol |
| Exact Mass | 776.23 |
| IUPAC Name | [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]-2-(2-oxoethyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](Oc1cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(CC=O)c(OS(=O)(=O)C(F)(F)F)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H43F3O6SSi2/c1-39(2,3)52(32-19-11-7-12-20-32,33-21-13-8-14-22-33)49-31-29-37(48-51(46,47)41(42,43)44)36(27-28-45)38(30-31)50-53(40(4,5)6,34-23-15-9-16-24-34)35-25-17-10-18-26-35/h7-26,28-30H,27H2,1-6H3 |
| InChIKey | GGDLEOZNXNSPTE-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.02 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|