C23H27NO4SSi — CID 101199405
N-[2-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]methanesulfonamide (PubChem CID 101199405) has the molecular formula C23H27NO4SSi and a molecular weight of 441.63 g/mol. Its IUPAC name is N-[2-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[2-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 101199405 |
| Molecular Formula | C23H27NO4SSi |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[2-[tert-butyl(diphenyl)silyl]oxy-5-hydroxyphenyl]methanesulfonamide |
| SMILES | CC(C)(C)[Si](Oc1ccc(O)cc1NS(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO4SSi/c1-23(2,3)30(19-11-7-5-8-12-19,20-13-9-6-10-14-20)28-22-16-15-18(25)17-21(22)24-29(4,26)27/h5-17,24-25H,1-4H3 |
| InChIKey | MDIZQKHHHJDRFK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|