C28H30O3Si — CID 102427831
[4-[tert-butyl(diphenyl)silyl]oxy-2,6-bis(ethenyl)phenyl] acetate (PubChem CID 102427831) has the molecular formula C28H30O3Si and a molecular weight of 442.63 g/mol. Its IUPAC name is [4-[tert-butyl(diphenyl)silyl]oxy-2,6-bis(ethenyl)phenyl] acetate.
| Compound Name | [4-[tert-butyl(diphenyl)silyl]oxy-2,6-bis(ethenyl)phenyl] acetate |
|---|---|
| PubChem CID | 102427831 |
| Molecular Formula | C28H30O3Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [4-[tert-butyl(diphenyl)silyl]oxy-2,6-bis(ethenyl)phenyl] acetate |
| SMILES | C=Cc1cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc(C=C)c1OC(C)=O |
| InChI | InChI=1S/C28H30O3Si/c1-7-22-19-24(20-23(8-2)27(22)30-21(3)29)31-32(28(4,5)6,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h7-20H,1-2H2,3-6H3 |
| InChIKey | FSUISLFQXGLJLM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|