C30H36F3N2OSi- — CID 162617200
tert-butyl-[2,2-difluoro-3-[[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]amino]propoxy]-diphenylsilanuide (PubChem CID 162617200) has the molecular formula C30H36F3N2OSi- and a molecular weight of 525.71 g/mol. Its IUPAC name is tert-butyl-[2,2-difluoro-3-[[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]amino]propoxy]-diphenylsilanuide.
| Compound Name | tert-butyl-[2,2-difluoro-3-[[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]amino]propoxy]-diphenylsilanuide |
|---|---|
| PubChem CID | 162617200 |
| Molecular Formula | C30H36F3N2OSi- |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | tert-butyl-[2,2-difluoro-3-[[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]amino]propoxy]-diphenylsilanuide |
| SMILES | C[C@H](Cc1c[nH]c2ccc(F)cc12)NCC(F)(F)CO[SiH-](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H36F3N2OSi/c1-22(17-23-19-34-28-16-15-24(31)18-27(23)28)35-20-30(32,33)21-36-37(29(2,3)4,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-16,18-19,22,34-35,37H,17,20-21H2,1-4H3/q-1/t22-/m1/s1 |
| InChIKey | FZOHSKDCWQMIEK-JOCHJYFZSA-N |
| XLogP | 5.77 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|