C18H25FN2 — CID 135277087
N-[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]-2-methyl-3-methylidenepentan-1-amine (PubChem CID 135277087) has the molecular formula C18H25FN2 and a molecular weight of 288.41 g/mol. Its IUPAC name is N-[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]-2-methyl-3-methylidenepentan-1-amine.
| Compound Name | N-[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]-2-methyl-3-methylidenepentan-1-amine |
|---|---|
| PubChem CID | 135277087 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[(2R)-1-(5-fluoro-1H-indol-3-yl)propan-2-yl]-2-methyl-3-methylidenepentan-1-amine |
| SMILES | C=C(CC)C(C)CN[C@H](C)Cc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C18H25FN2/c1-5-12(2)13(3)10-20-14(4)8-15-11-21-18-7-6-16(19)9-17(15)18/h6-7,9,11,13-14,20-21H,2,5,8,10H2,1,3-4H3/t13?,14-/m1/s1 |
| InChIKey | MOJVNHPFDOMRIS-ARLHGKGLSA-N |
| XLogP | 4.43 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|