C11H14F3NO — CID 175392255
3-[2-(1,2,2-trifluoroethylamino)propyl]phenol (PubChem CID 175392255) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-[2-(1,2,2-trifluoroethylamino)propyl]phenol.
| Compound Name | 3-[2-(1,2,2-trifluoroethylamino)propyl]phenol |
|---|---|
| PubChem CID | 175392255 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-[2-(1,2,2-trifluoroethylamino)propyl]phenol |
| SMILES | CC(Cc1cccc(O)c1)NC(F)C(F)F |
| InChI | InChI=1S/C11H14F3NO/c1-7(15-11(14)10(12)13)5-8-3-2-4-9(16)6-8/h2-4,6-7,10-11,15-16H,5H2,1H3 |
| InChIKey | HINOXAAVQGQMFO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|