C18H20F3NO — CID 175392263
1-(3-phenylmethoxyphenyl)-N-(1,2,2-trifluoroethyl)propan-2-amine (PubChem CID 175392263) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is 1-(3-phenylmethoxyphenyl)-N-(1,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | 1-(3-phenylmethoxyphenyl)-N-(1,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 175392263 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-(3-phenylmethoxyphenyl)-N-(1,2,2-trifluoroethyl)propan-2-amine |
| SMILES | CC(Cc1cccc(OCc2ccccc2)c1)NC(F)C(F)F |
| InChI | InChI=1S/C18H20F3NO/c1-13(22-18(21)17(19)20)10-15-8-5-9-16(11-15)23-12-14-6-3-2-4-7-14/h2-9,11,13,17-18,22H,10,12H2,1H3 |
| InChIKey | RIYHLGYYAQLTMZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|