C25H28ClNO — CID 140941375
4-cyclopropyl-N-[(2R)-1-(3-phenylmethoxyphenyl)propan-2-yl]aniline;hydrochloride (PubChem CID 140941375) has the molecular formula C25H28ClNO and a molecular weight of 393.96 g/mol. Its IUPAC name is 4-cyclopropyl-N-[(2R)-1-(3-phenylmethoxyphenyl)propan-2-yl]aniline;hydrochloride.
| Compound Name | 4-cyclopropyl-N-[(2R)-1-(3-phenylmethoxyphenyl)propan-2-yl]aniline;hydrochloride |
|---|---|
| PubChem CID | 140941375 |
| Molecular Formula | C25H28ClNO |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-cyclopropyl-N-[(2R)-1-(3-phenylmethoxyphenyl)propan-2-yl]aniline;hydrochloride |
| SMILES | C[C@H](Cc1cccc(OCc2ccccc2)c1)Nc1ccc(C2CC2)cc1.Cl |
| InChI | InChI=1S/C25H27NO.ClH/c1-19(26-24-14-12-23(13-15-24)22-10-11-22)16-21-8-5-9-25(17-21)27-18-20-6-3-2-4-7-20;/h2-9,12-15,17,19,22,26H,10-11,16,18H2,1H3;1H/t19-;/m1./s1 |
| InChIKey | GYJXECKTOLDPCQ-FSRHSHDFSA-N |
| XLogP | 6.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |