C20H21F3N2O — CID 175392250
(2R)-1-(5-phenylmethoxy-1H-indol-3-yl)-N-(1,2,2-trifluoroethyl)propan-2-amine (PubChem CID 175392250) has the molecular formula C20H21F3N2O and a molecular weight of 362.40 g/mol. Its IUPAC name is (2R)-1-(5-phenylmethoxy-1H-indol-3-yl)-N-(1,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | (2R)-1-(5-phenylmethoxy-1H-indol-3-yl)-N-(1,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 175392250 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (2R)-1-(5-phenylmethoxy-1H-indol-3-yl)-N-(1,2,2-trifluoroethyl)propan-2-amine |
| SMILES | C[C@H](Cc1c[nH]c2ccc(OCc3ccccc3)cc12)NC(F)C(F)F |
| InChI | InChI=1S/C20H21F3N2O/c1-13(25-20(23)19(21)22)9-15-11-24-18-8-7-16(10-17(15)18)26-12-14-5-3-2-4-6-14/h2-8,10-11,13,19-20,24-25H,9,12H2,1H3/t13-,20?/m1/s1 |
| InChIKey | HZWMBSLTAZROFE-CRIUFTBBSA-N |
| XLogP | 4.83 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|