C28H35F2NO3Si — CID 175396870
4-[2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]benzene-1,2-diol (PubChem CID 175396870) has the molecular formula C28H35F2NO3Si and a molecular weight of 499.67 g/mol. Its IUPAC name is 4-[2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]benzene-1,2-diol.
| Compound Name | 4-[2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 175396870 |
| Molecular Formula | C28H35F2NO3Si |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 4-[2-[[3-[tert-butyl(diphenyl)silyl]oxy-2,2-difluoropropyl]amino]propyl]benzene-1,2-diol |
| SMILES | CC(Cc1ccc(O)c(O)c1)NCC(F)(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H35F2NO3Si/c1-21(17-22-15-16-25(32)26(33)18-22)31-19-28(29,30)20-34-35(27(2,3)4,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-16,18,21,31-33H,17,19-20H2,1-4H3 |
| InChIKey | FTVXPXVMGNMQSE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|