C21H26O2Si — CID 101467335
tert-butyl-(3,6-dihydro-2H-pyran-4-yloxy)-diphenylsilane (PubChem CID 101467335) has the molecular formula C21H26O2Si and a molecular weight of 338.52 g/mol. Its IUPAC name is tert-butyl-(3,6-dihydro-2H-pyran-4-yloxy)-diphenylsilane.
| Compound Name | tert-butyl-(3,6-dihydro-2H-pyran-4-yloxy)-diphenylsilane |
|---|---|
| PubChem CID | 101467335 |
| Molecular Formula | C21H26O2Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl-(3,6-dihydro-2H-pyran-4-yloxy)-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC1=CCOCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26O2Si/c1-21(2,3)24(19-10-6-4-7-11-19,20-12-8-5-9-13-20)23-18-14-16-22-17-15-18/h4-14H,15-17H2,1-3H3 |
| InChIKey | ASLIWCWCZUIORZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|