C26H28OSi — CID 101450805
tert-butyl-[2-(cyclopropylidenemethyl)phenoxy]-diphenylsilane (PubChem CID 101450805) has the molecular formula C26H28OSi and a molecular weight of 384.60 g/mol. Its IUPAC name is tert-butyl-[2-(cyclopropylidenemethyl)phenoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-(cyclopropylidenemethyl)phenoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101450805 |
| Molecular Formula | C26H28OSi |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | tert-butyl-[2-(cyclopropylidenemethyl)phenoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1ccccc1C=C1CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28OSi/c1-26(2,3)28(23-13-6-4-7-14-23,24-15-8-5-9-16-24)27-25-17-11-10-12-22(25)20-21-18-19-21/h4-17,20H,18-19H2,1-3H3 |
| InChIKey | XTNHSDNNJFSSAV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|