C26H27NO2SSi — CID 11430731
(4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyphenyl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde (PubChem CID 11430731) has the molecular formula C26H27NO2SSi and a molecular weight of 445.66 g/mol. Its IUPAC name is (4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyphenyl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde.
| Compound Name | (4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyphenyl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 11430731 |
| Molecular Formula | C26H27NO2SSi |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (4S)-2-[2-[tert-butyl(diphenyl)silyl]oxyphenyl]-4,5-dihydro-1,3-thiazole-4-carbaldehyde |
| SMILES | CC(C)(C)[Si](Oc1ccccc1C1=N[C@@H](C=O)CS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2SSi/c1-26(2,3)31(21-12-6-4-7-13-21,22-14-8-5-9-15-22)29-24-17-11-10-16-23(24)25-27-20(18-28)19-30-25/h4-18,20H,19H2,1-3H3/t20-/m0/s1 |
| InChIKey | WOUAXCKBBJINSI-FQEVSTJZSA-N |
| XLogP | 4.69 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|