C41H44O2Si2 — CID 69332486
tert-butyl-[[3-[tert-butyl(diphenyl)silyl]oxy-3H-inden-4-yl]oxy]-diphenylsilane (PubChem CID 69332486) has the molecular formula C41H44O2Si2 and a molecular weight of 624.97 g/mol. Its IUPAC name is tert-butyl-[[3-[tert-butyl(diphenyl)silyl]oxy-3H-inden-4-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[3-[tert-butyl(diphenyl)silyl]oxy-3H-inden-4-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 69332486 |
| Molecular Formula | C41H44O2Si2 |
| Molecular Weight | 624.97 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | tert-butyl-[[3-[tert-butyl(diphenyl)silyl]oxy-3H-inden-4-yl]oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1cccc2c1C(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C=C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H44O2Si2/c1-40(2,3)44(33-21-11-7-12-22-33,34-23-13-8-14-24-34)42-37-29-19-20-32-30-31-38(39(32)37)43-45(41(4,5)6,35-25-15-9-16-26-35)36-27-17-10-18-28-36/h7-31,38H,1-6H3 |
| InChIKey | FZTBQCKYCLVISG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.97 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|