C30H30OSi — CID 87787763
tert-butyl-[(1-cyclopenta-1,4-dien-1-yl-1H-inden-4-yl)oxy]-diphenylsilane (PubChem CID 87787763) has the molecular formula C30H30OSi and a molecular weight of 434.66 g/mol. Its IUPAC name is tert-butyl-[(1-cyclopenta-1,4-dien-1-yl-1H-inden-4-yl)oxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1-cyclopenta-1,4-dien-1-yl-1H-inden-4-yl)oxy]-diphenylsilane |
|---|---|
| PubChem CID | 87787763 |
| Molecular Formula | C30H30OSi |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | tert-butyl-[(1-cyclopenta-1,4-dien-1-yl-1H-inden-4-yl)oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1cccc2c1C=CC2C1=CCC=C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30OSi/c1-30(2,3)32(24-15-6-4-7-16-24,25-17-8-5-9-18-25)31-29-20-12-19-27-26(21-22-28(27)29)23-13-10-11-14-23/h4-10,12-22,26H,11H2,1-3H3 |
| InChIKey | WZIGIXQLYXLNIX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|