C29H34O5Si — CID 54371121
ethyl (1S,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylate (PubChem CID 54371121) has the molecular formula C29H34O5Si and a molecular weight of 490.67 g/mol. Its IUPAC name is ethyl (1S,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylate.
| Compound Name | ethyl (1S,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 54371121 |
| Molecular Formula | C29H34O5Si |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | ethyl (1S,2R)-5-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxy-3,4-dihydro-1H-naphthalene-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(O)CCc2c(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cccc2[C@@H]1O |
| InChI | InChI=1S/C29H34O5Si/c1-5-33-27(31)29(32)20-19-23-24(26(29)30)17-12-18-25(23)34-35(28(2,3)4,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-18,26,30,32H,5,19-20H2,1-4H3/t26-,29+/m0/s1 |
| InChIKey | UTHBPDUXWLLPGP-LITSAYRRSA-N |
| XLogP | 3.90 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|