C41H43NO5Si — CID 22467311
[1-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl]methyl N,N-diphenylcarbamate (PubChem CID 22467311) has the molecular formula C41H43NO5Si and a molecular weight of 657.88 g/mol. Its IUPAC name is [1-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl]methyl N,N-diphenylcarbamate.
| Compound Name | [1-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl]methyl N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 22467311 |
| Molecular Formula | C41H43NO5Si |
| Molecular Weight | 657.88 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | [1-[tert-butyl(diphenyl)silyl]oxy-6,7-dihydroxy-5,7,8,9-tetrahydrobenzo[7]annulen-6-yl]methyl N,N-diphenylcarbamate |
| SMILES | CC(C)(C)[Si](Oc1cccc2c1CCC(O)C(O)(COC(=O)N(c1ccccc1)c1ccccc1)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H43NO5Si/c1-40(2,3)48(34-22-12-6-13-23-34,35-24-14-7-15-25-35)47-37-26-16-17-31-29-41(45,38(43)28-27-36(31)37)30-46-39(44)42(32-18-8-4-9-19-32)33-20-10-5-11-21-33/h4-26,38,43,45H,27-30H2,1-3H3 |
| InChIKey | OJCBMCCMFKXFPB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.88 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|