C28H34O3Si — CID 20691703
cis-(1S,2S)-1-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]cyclopentane-1,2-diol (PubChem CID 20691703) has the molecular formula C28H34O3Si and a molecular weight of 446.66 g/mol. Its IUPAC name is cis-(1S,2S)-1-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]cyclopentane-1,2-diol.
| Compound Name | cis-(1S,2S)-1-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 20691703 |
| Molecular Formula | C28H34O3Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | cis-(1S,2S)-1-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]cyclopentane-1,2-diol |
| SMILES | CC(C)(C)[Si](Oc1cccc(C[C@@]2(O)CCC[C@@H]2O)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O3Si/c1-27(2,3)32(24-14-6-4-7-15-24,25-16-8-5-9-17-25)31-23-13-10-12-22(20-23)21-28(30)19-11-18-26(28)29/h4-10,12-17,20,26,29-30H,11,18-19,21H2,1-3H3/t26-,28-/m0/s1 |
| InChIKey | DUYCAUWQQVMCII-XCZPVHLTSA-N |
| XLogP | 4.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|