C32H42O3Si2 — CID 86757468
(2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]-2-trimethylsilyloxycyclohexan-1-one (PubChem CID 86757468) has the molecular formula C32H42O3Si2 and a molecular weight of 530.86 g/mol. Its IUPAC name is (2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]-2-trimethylsilyloxycyclohexan-1-one.
| Compound Name | (2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]-2-trimethylsilyloxycyclohexan-1-one |
|---|---|
| PubChem CID | 86757468 |
| Molecular Formula | C32H42O3Si2 |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (2R)-2-[[3-[tert-butyl(diphenyl)silyl]oxyphenyl]methyl]-2-trimethylsilyloxycyclohexan-1-one |
| SMILES | CC(C)(C)[Si](Oc1cccc(C[C@]2(O[Si](C)(C)C)CCCCC2=O)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H42O3Si2/c1-31(2,3)37(28-18-9-7-10-19-28,29-20-11-8-12-21-29)34-27-17-15-16-26(24-27)25-32(35-36(4,5)6)23-14-13-22-30(32)33/h7-12,15-21,24H,13-14,22-23,25H2,1-6H3/t32-/m1/s1 |
| InChIKey | AUOAZNATALJXGI-JGCGQSQUSA-N |
| XLogP | 6.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|