C38H42O2Si — CID 22163045
[6-(2-adamantylidenemethoxymethyl)naphthalen-2-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 22163045) has the molecular formula C38H42O2Si and a molecular weight of 558.84 g/mol. Its IUPAC name is [6-(2-adamantylidenemethoxymethyl)naphthalen-2-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [6-(2-adamantylidenemethoxymethyl)naphthalen-2-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 22163045 |
| Molecular Formula | C38H42O2Si |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | [6-(2-adamantylidenemethoxymethyl)naphthalen-2-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1ccc2cc(COC=C3C4CC5CC(C4)CC3C5)ccc2c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H42O2Si/c1-38(2,3)41(35-10-6-4-7-11-35,36-12-8-5-9-13-36)40-34-17-16-30-19-27(14-15-31(30)24-34)25-39-26-37-32-20-28-18-29(22-32)23-33(37)21-28/h4-17,19,24,26,28-29,32-33H,18,20-23,25H2,1-3H3/b37-26- |
| InChIKey | IWSIADIBXHIDQF-UOZKZNBHSA-N |
| XLogP | 8.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|