C36H38O4Si — CID 101342746
7-[tert-butyl(diphenyl)silyl]oxy-2-[(1-methylcyclohexyl)methyl]dibenzofuran-1,4-dione (PubChem CID 101342746) has the molecular formula C36H38O4Si and a molecular weight of 562.78 g/mol. Its IUPAC name is 7-[tert-butyl(diphenyl)silyl]oxy-2-[(1-methylcyclohexyl)methyl]dibenzofuran-1,4-dione.
| Compound Name | 7-[tert-butyl(diphenyl)silyl]oxy-2-[(1-methylcyclohexyl)methyl]dibenzofuran-1,4-dione |
|---|---|
| PubChem CID | 101342746 |
| Molecular Formula | C36H38O4Si |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 7-[tert-butyl(diphenyl)silyl]oxy-2-[(1-methylcyclohexyl)methyl]dibenzofuran-1,4-dione |
| SMILES | CC1(CC2=CC(=O)c3oc4cc(O[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)ccc4c3C2=O)CCCCC1 |
| InChI | InChI=1S/C36H38O4Si/c1-35(2,3)41(27-14-8-5-9-15-27,28-16-10-6-11-17-28)40-26-18-19-29-31(23-26)39-34-30(37)22-25(33(38)32(29)34)24-36(4)20-12-7-13-21-36/h5-6,8-11,14-19,22-23H,7,12-13,20-21,24H2,1-4H3 |
| InChIKey | DHSJZPHHBSCBCX-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|