C27H31NO4Si — CID 91220929
2-[[5-[tert-butyl(diphenyl)silyl]oxy-2-pyridinyl]methyl]oxolane-2-carboxylic acid (PubChem CID 91220929) has the molecular formula C27H31NO4Si and a molecular weight of 461.63 g/mol. Its IUPAC name is 2-[[5-[tert-butyl(diphenyl)silyl]oxy-2-pyridinyl]methyl]oxolane-2-carboxylic acid.
| Compound Name | 2-[[5-[tert-butyl(diphenyl)silyl]oxy-2-pyridinyl]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 91220929 |
| Molecular Formula | C27H31NO4Si |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-[[5-[tert-butyl(diphenyl)silyl]oxy-2-pyridinyl]methyl]oxolane-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](Oc1ccc(CC2(C(=O)O)CCCO2)nc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31NO4Si/c1-26(2,3)33(23-11-6-4-7-12-23,24-13-8-5-9-14-24)32-22-16-15-21(28-20-22)19-27(25(29)30)17-10-18-31-27/h4-9,11-16,20H,10,17-19H2,1-3H3,(H,29,30) |
| InChIKey | GIVRZMUEWFWYGB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|