C36H44O4Si — CID 59032115
(11'R)-3'-[tert-butyl(diphenyl)silyl]oxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-11'-ol (PubChem CID 59032115) has the molecular formula C36H44O4Si and a molecular weight of 568.83 g/mol. Its IUPAC name is (11'R)-3'-[tert-butyl(diphenyl)silyl]oxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-11'-ol.
| Compound Name | (11'R)-3'-[tert-butyl(diphenyl)silyl]oxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-11'-ol |
|---|---|
| PubChem CID | 59032115 |
| Molecular Formula | C36H44O4Si |
| Molecular Weight | 568.83 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (11'R)-3'-[tert-butyl(diphenyl)silyl]oxy-13'-methylspiro[1,3-dioxolane-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-11'-ol |
| SMILES | CC12C[C@@H](O)C3c4ccc(O[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)cc4CCC3C1CCC21OCCO1 |
| InChI | InChI=1S/C36H44O4Si/c1-34(2,3)41(27-11-7-5-8-12-27,28-13-9-6-10-14-28)40-26-16-18-29-25(23-26)15-17-30-31-19-20-36(38-21-22-39-36)35(31,4)24-32(37)33(29)30/h5-14,16,18,23,30-33,37H,15,17,19-22,24H2,1-4H3/t30?,31?,32-,33?,35?/m1/s1 |
| InChIKey | SMYPKNGBPINLQR-JPBSOONLSA-N |
| XLogP | 6.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.83 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|