C41H41NO3Si — CID 57109599
[1-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulen-9-yl]methyl N,N-diphenylcarbamate (PubChem CID 57109599) has the molecular formula C41H41NO3Si and a molecular weight of 623.87 g/mol. Its IUPAC name is [1-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulen-9-yl]methyl N,N-diphenylcarbamate.
| Compound Name | [1-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulen-9-yl]methyl N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 57109599 |
| Molecular Formula | C41H41NO3Si |
| Molecular Weight | 623.87 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | [1-[tert-butyl(diphenyl)silyl]oxy-8,9-dihydro-5H-benzo[7]annulen-9-yl]methyl N,N-diphenylcarbamate |
| SMILES | CC(C)(C)[Si](Oc1cccc2c1C(COC(=O)N(c1ccccc1)c1ccccc1)CC=CC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H41NO3Si/c1-41(2,3)46(36-26-12-6-13-27-36,37-28-14-7-15-29-37)45-38-30-18-21-32-19-16-17-20-33(39(32)38)31-44-40(43)42(34-22-8-4-9-23-34)35-24-10-5-11-25-35/h4-18,21-30,33H,19-20,31H2,1-3H3 |
| InChIKey | FMPKZJFQWIUUNM-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.87 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|