C44H62O4Si2 — CID 11017979
(4S,6R,7S,9E)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-4-prop-2-enyl-16-tri(propan-2-yl)silyloxy-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one (PubChem CID 11017979) has the molecular formula C44H62O4Si2 and a molecular weight of 711.15 g/mol. Its IUPAC name is (4S,6R,7S,9E)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-4-prop-2-enyl-16-tri(propan-2-yl)silyloxy-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one.
| Compound Name | (4S,6R,7S,9E)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-4-prop-2-enyl-16-tri(propan-2-yl)silyloxy-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one |
|---|---|
| PubChem CID | 11017979 |
| Molecular Formula | C44H62O4Si2 |
| Molecular Weight | 711.15 g/mol |
| Exact Mass | 710.42 |
| IUPAC Name | (4S,6R,7S,9E)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-4-prop-2-enyl-16-tri(propan-2-yl)silyloxy-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-2-one |
| SMILES | C=CC[C@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C)C/C=C/Cc2cccc(O[Si](C(C)C)(C(C)C)C(C)C)c2C(=O)O1 |
| InChI | InChI=1S/C44H62O4Si2/c1-12-22-37-31-41(48-50(44(9,10)11,38-26-15-13-16-27-38)39-28-17-14-18-29-39)35(8)23-19-20-24-36-25-21-30-40(42(36)43(45)46-37)47-49(32(2)3,33(4)5)34(6)7/h12-21,25-30,32-35,37,41H,1,22-24,31H2,2-11H3/b20-19+/t35-,37-,41+/m0/s1 |
| InChIKey | JHZQLJWZTGWQPT-RKOJBCPOSA-N |
| XLogP | 10.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.15 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|