C25H32O4 — CID 59093298
prop-2-enyl (E)-4-[(4S,6R,7S,9E)-6,7,16-trimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraen-4-yl]but-2-enoate (PubChem CID 59093298) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is prop-2-enyl (E)-4-[(4S,6R,7S,9E)-6,7,16-trimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraen-4-yl]but-2-enoate.
| Compound Name | prop-2-enyl (E)-4-[(4S,6R,7S,9E)-6,7,16-trimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraen-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 59093298 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | prop-2-enyl (E)-4-[(4S,6R,7S,9E)-6,7,16-trimethyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(16),9,12,14-tetraen-4-yl]but-2-enoate |
| SMILES | C=CCOC(=O)/C=C/C[C@H]1C[C@@H](C)[C@@H](C)C/C=C/Cc2cccc(C)c2C(=O)O1 |
| InChI | InChI=1S/C25H32O4/c1-5-16-28-23(26)15-9-14-22-17-20(4)18(2)10-6-7-12-21-13-8-11-19(3)24(21)25(27)29-22/h5-9,11,13,15,18,20,22H,1,10,12,14,16-17H2,2-4H3/b7-6+,15-9+/t18-,20+,22-/m0/s1 |
| InChIKey | RPMMXFWKRLOSPW-OBPYJIIJSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|