C20H30O3 — CID 59093349
(4R,6R,7S)-4-(2-hydroxyethyl)-6,7,16-trimethyl-3-oxabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-one (PubChem CID 59093349) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4R,6R,7S)-4-(2-hydroxyethyl)-6,7,16-trimethyl-3-oxabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-one.
| Compound Name | (4R,6R,7S)-4-(2-hydroxyethyl)-6,7,16-trimethyl-3-oxabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-one |
|---|---|
| PubChem CID | 59093349 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4R,6R,7S)-4-(2-hydroxyethyl)-6,7,16-trimethyl-3-oxabicyclo[10.4.0]hexadeca-1(16),12,14-trien-2-one |
| SMILES | Cc1cccc2c1C(=O)O[C@@H](CCO)C[C@@H](C)[C@@H](C)CCCC2 |
| InChI | InChI=1S/C20H30O3/c1-14-7-4-5-9-17-10-6-8-15(2)19(17)20(22)23-18(11-12-21)13-16(14)3/h6,8,10,14,16,18,21H,4-5,7,9,11-13H2,1-3H3/t14-,16+,18-/m0/s1 |
| InChIKey | QOUYMLPWJXPTDY-LESCRADOSA-N |
| XLogP | 4.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |