C26H38N2O5 — CID 10139333
N-[(E)-2-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]ethylideneamino]octanamide (PubChem CID 10139333) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[(E)-2-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]ethylideneamino]octanamide.
| Compound Name | N-[(E)-2-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]ethylideneamino]octanamide |
|---|---|
| PubChem CID | 10139333 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | N-[(E)-2-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]ethylideneamino]octanamide |
| SMILES | CCCCCCCC(=O)N/N=C/CC1CC(O)C(C)C/C=C/Cc2cccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C26H38N2O5/c1-3-4-5-6-7-15-24(31)28-27-17-16-21-18-23(30)19(2)11-8-9-12-20-13-10-14-22(29)25(20)26(32)33-21/h8-10,13-14,17,19,21,23,29-30H,3-7,11-12,15-16,18H2,1-2H3,(H,28,31)/b9-8+,27-17+ |
| InChIKey | UTFGRDCWHDDURM-AWWZCKKOSA-N |
| XLogP | 4.66 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|