C33H41NO7 — CID 56943004
[(9Z)-4-[(E)-3-(hexoxycarbonylamino)prop-2-enyl]-16-hydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-6-yl] benzoate (PubChem CID 56943004) has the molecular formula C33H41NO7 and a molecular weight of 563.69 g/mol. Its IUPAC name is [(9Z)-4-[(E)-3-(hexoxycarbonylamino)prop-2-enyl]-16-hydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-6-yl] benzoate.
| Compound Name | [(9Z)-4-[(E)-3-(hexoxycarbonylamino)prop-2-enyl]-16-hydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-6-yl] benzoate |
|---|---|
| PubChem CID | 56943004 |
| Molecular Formula | C33H41NO7 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | [(9Z)-4-[(E)-3-(hexoxycarbonylamino)prop-2-enyl]-16-hydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-6-yl] benzoate |
| SMILES | CCCCCCOC(=O)N/C=C/CC1CC(OC(=O)c2ccccc2)C(C)C/C=C\Cc2cccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C33H41NO7/c1-3-4-5-11-22-39-33(38)34-21-13-19-27-23-29(41-31(36)26-16-7-6-8-17-26)24(2)14-9-10-15-25-18-12-20-28(35)30(25)32(37)40-27/h6-10,12-13,16-18,20-21,24,27,29,35H,3-5,11,14-15,19,22-23H2,1-2H3,(H,34,38)/b10-9-,21-13+ |
| InChIKey | AVHXYNGSCPCTRX-DRJJNECNSA-N |
| XLogP | 6.88 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|