C25H35NO6 — CID 10297340
pentyl N-[(E)-3-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]prop-1-enyl]carbamate (PubChem CID 10297340) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is pentyl N-[(E)-3-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]prop-1-enyl]carbamate.
| Compound Name | pentyl N-[(E)-3-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]prop-1-enyl]carbamate |
|---|---|
| PubChem CID | 10297340 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | pentyl N-[(E)-3-[(9E)-6,16-dihydroxy-7-methyl-2-oxo-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraen-4-yl]prop-1-enyl]carbamate |
| SMILES | CCCCCOC(=O)N/C=C/CC1CC(O)C(C)C/C=C/Cc2cccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C25H35NO6/c1-3-4-7-16-31-25(30)26-15-9-13-20-17-22(28)18(2)10-5-6-11-19-12-8-14-21(27)23(19)24(29)32-20/h5-6,8-9,12,14-15,18,20,22,27-28H,3-4,7,10-11,13,16-17H2,1-2H3,(H,26,30)/b6-5+,15-9+ |
| InChIKey | FQMNBNXUEXRBKG-LODDJISYSA-N |
| XLogP | 4.63 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|