C27H32N2O8 — CID 162983062
N-[3-[(4S,8S,11R)-11,19-dihydroxy-8,12-dimethyl-2,6-dioxo-3,7-dioxabicyclo[13.4.0]nonadeca-1(15),9,12,16,18-pentaen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide (PubChem CID 162983062) has the molecular formula C27H32N2O8 and a molecular weight of 512.56 g/mol. Its IUPAC name is N-[3-[(4S,8S,11R)-11,19-dihydroxy-8,12-dimethyl-2,6-dioxo-3,7-dioxabicyclo[13.4.0]nonadeca-1(15),9,12,16,18-pentaen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide.
| Compound Name | N-[3-[(4S,8S,11R)-11,19-dihydroxy-8,12-dimethyl-2,6-dioxo-3,7-dioxabicyclo[13.4.0]nonadeca-1(15),9,12,16,18-pentaen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide |
|---|---|
| PubChem CID | 162983062 |
| Molecular Formula | C27H32N2O8 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | N-[3-[(4S,8S,11R)-11,19-dihydroxy-8,12-dimethyl-2,6-dioxo-3,7-dioxabicyclo[13.4.0]nonadeca-1(15),9,12,16,18-pentaen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide |
| SMILES | CON=CC=CC(=O)NC=CC[C@H]1CC(=O)O[C@@H](C)C=C[C@@H](O)C(C)=CCc2cccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C27H32N2O8/c1-18-11-13-20-7-4-9-23(31)26(20)27(34)37-21(17-25(33)36-19(2)12-14-22(18)30)8-5-15-28-24(32)10-6-16-29-35-3/h4-7,9-12,14-16,19,21-22,30-31H,8,13,17H2,1-3H3,(H,28,32)/t19-,21-,22+/m0/s1 |
| InChIKey | JYHIHHYYXXKTTJ-ILWGZMRPSA-N |
| XLogP | 2.87 |
| TPSA | 143.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|