C24H28N2O7 — CID 11080966
(E,4E)-N-[(E)-3-[(4S,11Z)-18-hydroxy-2,6-dioxo-3,7-dioxabicyclo[12.4.0]octadeca-1(14),11,15,17-tetraen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide (PubChem CID 11080966) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is (E,4E)-N-[(E)-3-[(4S,11Z)-18-hydroxy-2,6-dioxo-3,7-dioxabicyclo[12.4.0]octadeca-1(14),11,15,17-tetraen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide.
| Compound Name | (E,4E)-N-[(E)-3-[(4S,11Z)-18-hydroxy-2,6-dioxo-3,7-dioxabicyclo[12.4.0]octadeca-1(14),11,15,17-tetraen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide |
|---|---|
| PubChem CID | 11080966 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (E,4E)-N-[(E)-3-[(4S,11Z)-18-hydroxy-2,6-dioxo-3,7-dioxabicyclo[12.4.0]octadeca-1(14),11,15,17-tetraen-4-yl]prop-1-enyl]-4-methoxyiminobut-2-enamide |
| SMILES | CO/N=C/C=C/C(=O)N/C=C/C[C@H]1CC(=O)OCCC/C=C\Cc2cccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C24H28N2O7/c1-31-26-15-8-13-21(28)25-14-7-11-19-17-22(29)32-16-5-3-2-4-9-18-10-6-12-20(27)23(18)24(30)33-19/h2,4,6-8,10,12-15,19,27H,3,5,9,11,16-17H2,1H3,(H,25,28)/b4-2-,13-8+,14-7+,26-15+/t19-/m0/s1 |
| InChIKey | PXDHHWWATJICSM-BDIXNQQVSA-N |
| XLogP | 2.95 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|