C22H26O7 — CID 102572170
prop-2-enyl (E)-4-[(1S,11S,13R)-7,15-dihydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]but-2-enoate (PubChem CID 102572170) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is prop-2-enyl (E)-4-[(1S,11S,13R)-7,15-dihydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]but-2-enoate.
| Compound Name | prop-2-enyl (E)-4-[(1S,11S,13R)-7,15-dihydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]but-2-enoate |
|---|---|
| PubChem CID | 102572170 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | prop-2-enyl (E)-4-[(1S,11S,13R)-7,15-dihydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]but-2-enoate |
| SMILES | C=CCOC(=O)/C=C/C[C@H]1C[C@H]2CC(O)C[C@H](Cc3cccc(O)c3C(=O)O1)O2 |
| InChI | InChI=1S/C22H26O7/c1-2-9-27-20(25)8-4-6-16-13-18-12-15(23)11-17(28-18)10-14-5-3-7-19(24)21(14)22(26)29-16/h2-5,7-8,15-18,23-24H,1,6,9-13H2/b8-4+/t15?,16-,17-,18+/m0/s1 |
| InChIKey | HRLOYXQYAHGLSB-FIAHKBMISA-N |
| XLogP | 2.45 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|