C27H32O6 — CID 11775334
(1S,11S,13R,15R)-7-(methoxymethoxy)-15-phenylmethoxy-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one (PubChem CID 11775334) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is (1S,11S,13R,15R)-7-(methoxymethoxy)-15-phenylmethoxy-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one.
| Compound Name | (1S,11S,13R,15R)-7-(methoxymethoxy)-15-phenylmethoxy-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one |
|---|---|
| PubChem CID | 11775334 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (1S,11S,13R,15R)-7-(methoxymethoxy)-15-phenylmethoxy-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one |
| SMILES | C=CC[C@H]1C[C@H]2C[C@H](OCc3ccccc3)C[C@H](Cc3cccc(OCOC)c3C(=O)O1)O2 |
| InChI | InChI=1S/C27H32O6/c1-3-8-21-14-24-16-22(30-17-19-9-5-4-6-10-19)15-23(32-24)13-20-11-7-12-25(31-18-29-2)26(20)27(28)33-21/h3-7,9-12,21-24H,1,8,13-18H2,2H3/t21-,22+,23-,24-/m0/s1 |
| InChIKey | LJMUWIRAJWQJMU-KIHHCIJBSA-N |
| XLogP | 4.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|