C21H23N3O3 — CID 102070373
(3S)-3-[(1S)-1-azido-3-methylbutyl]-8-phenylmethoxy-3,4-dihydroisochromen-1-one (PubChem CID 102070373) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (3S)-3-[(1S)-1-azido-3-methylbutyl]-8-phenylmethoxy-3,4-dihydroisochromen-1-one.
| Compound Name | (3S)-3-[(1S)-1-azido-3-methylbutyl]-8-phenylmethoxy-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 102070373 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (3S)-3-[(1S)-1-azido-3-methylbutyl]-8-phenylmethoxy-3,4-dihydroisochromen-1-one |
| SMILES | CC(C)C[C@H](N=[N+]=[N-])[C@@H]1Cc2cccc(OCc3ccccc3)c2C(=O)O1 |
| InChI | InChI=1S/C21H23N3O3/c1-14(2)11-17(23-24-22)19-12-16-9-6-10-18(20(16)21(25)27-19)26-13-15-7-4-3-5-8-15/h3-10,14,17,19H,11-13H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | BOICTNZNRORIPJ-HKUYNNGSSA-N |
| XLogP | 5.07 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|