C19H22O5 — CID 11771864
(4S,6S,9E)-6-hydroxy-16-methoxy-4-prop-2-enyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-2,8-dione (PubChem CID 11771864) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (4S,6S,9E)-6-hydroxy-16-methoxy-4-prop-2-enyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-2,8-dione.
| Compound Name | (4S,6S,9E)-6-hydroxy-16-methoxy-4-prop-2-enyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-2,8-dione |
|---|---|
| PubChem CID | 11771864 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (4S,6S,9E)-6-hydroxy-16-methoxy-4-prop-2-enyl-3-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-2,8-dione |
| SMILES | C=CC[C@H]1C[C@H](O)CC(=O)/C=C/Cc2cccc(OC)c2C(=O)O1 |
| InChI | InChI=1S/C19H22O5/c1-3-6-16-12-15(21)11-14(20)9-4-7-13-8-5-10-17(23-2)18(13)19(22)24-16/h3-5,8-10,15-16,21H,1,6-7,11-12H2,2H3/b9-4+/t15-,16+/m1/s1 |
| InChIKey | YMQROCXYNUHUDI-VVXZVVLWSA-N |
| XLogP | 2.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|