C30H50O5Si2 — CID 101116086
(1R,11R,13S,15S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one (PubChem CID 101116086) has the molecular formula C30H50O5Si2 and a molecular weight of 546.90 g/mol. Its IUPAC name is (1R,11R,13S,15S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one.
| Compound Name | (1R,11R,13S,15S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one |
|---|---|
| PubChem CID | 101116086 |
| Molecular Formula | C30H50O5Si2 |
| Molecular Weight | 546.90 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | (1R,11R,13S,15S)-7,15-bis[[tert-butyl(dimethyl)silyl]oxy]-11-prop-2-enyl-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-9-one |
| SMILES | C=CC[C@@H]1C[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](Cc3cccc(O[Si](C)(C)C(C)(C)C)c3C(=O)O1)O2 |
| InChI | InChI=1S/C30H50O5Si2/c1-12-14-22-18-24-20-25(34-36(8,9)29(2,3)4)19-23(32-24)17-21-15-13-16-26(27(21)28(31)33-22)35-37(10,11)30(5,6)7/h12-13,15-16,22-25H,1,14,17-20H2,2-11H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | UCZRRSKJPSAXRF-NGSHPTGOSA-N |
| XLogP | 8.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.90 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|