C24H35IO4Si — CID 135076832
(1S,11S,13S,15R)-15-[tert-butyl(dimethyl)silyl]oxy-11-[(E)-3-iodoprop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3,5,7-trien-9-one (PubChem CID 135076832) has the molecular formula C24H35IO4Si and a molecular weight of 542.53 g/mol. Its IUPAC name is (1S,11S,13S,15R)-15-[tert-butyl(dimethyl)silyl]oxy-11-[(E)-3-iodoprop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3,5,7-trien-9-one.
| Compound Name | (1S,11S,13S,15R)-15-[tert-butyl(dimethyl)silyl]oxy-11-[(E)-3-iodoprop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3,5,7-trien-9-one |
|---|---|
| PubChem CID | 135076832 |
| Molecular Formula | C24H35IO4Si |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | (1S,11S,13S,15R)-15-[tert-butyl(dimethyl)silyl]oxy-11-[(E)-3-iodoprop-2-enyl]-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3,5,7-trien-9-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2Cc3ccccc3C(=O)O[C@@H](C/C=C/I)C[C@@H](C1)O2 |
| InChI | InChI=1S/C24H35IO4Si/c1-24(2,3)30(4,5)29-21-15-19-13-17-9-6-7-11-22(17)23(26)28-18(10-8-12-25)14-20(16-21)27-19/h6-9,11-12,18-21H,10,13-16H2,1-5H3/b12-8+/t18-,19-,20-,21+/m0/s1 |
| InChIKey | XXEBNQOJXDVBIR-YHSRJWKDSA-N |
| XLogP | 6.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|