C41H43NO4Si — CID 70187793
2-[(1R,2R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl N,N-diphenylcarbamate (PubChem CID 70187793) has the molecular formula C41H43NO4Si and a molecular weight of 641.88 g/mol. Its IUPAC name is 2-[(1R,2R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl N,N-diphenylcarbamate.
| Compound Name | 2-[(1R,2R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 70187793 |
| Molecular Formula | C41H43NO4Si |
| Molecular Weight | 641.88 g/mol |
| Exact Mass | 641.30 |
| IUPAC Name | 2-[(1R,2R)-5-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]ethyl N,N-diphenylcarbamate |
| SMILES | CC(C)(C)[Si](Oc1cccc2c1CC[C@@H](O)[C@@H]2CCOC(=O)N(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H43NO4Si/c1-41(2,3)47(33-21-12-6-13-22-33,34-23-14-7-15-24-34)46-39-26-16-25-35-36(38(43)28-27-37(35)39)29-30-45-40(44)42(31-17-8-4-9-18-31)32-19-10-5-11-20-32/h4-26,36,38,43H,27-30H2,1-3H3/t36-,38-/m1/s1 |
| InChIKey | NZGUQJKGKJRZDL-XXKIVBBDSA-N |
| XLogP | 8.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.88 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|