C26H29N3OSi — CID 18367327
(5-azido-5,6,7,8-tetrahydronaphthalen-1-yl)oxy-tert-butyl-diphenylsilane (PubChem CID 18367327) has the molecular formula C26H29N3OSi and a molecular weight of 427.62 g/mol. Its IUPAC name is (5-azido-5,6,7,8-tetrahydronaphthalen-1-yl)oxy-tert-butyl-diphenylsilane.
| Compound Name | (5-azido-5,6,7,8-tetrahydronaphthalen-1-yl)oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 18367327 |
| Molecular Formula | C26H29N3OSi |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | (5-azido-5,6,7,8-tetrahydronaphthalen-1-yl)oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](Oc1cccc2c1CCCC2N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3OSi/c1-26(2,3)31(20-12-6-4-7-13-20,21-14-8-5-9-15-21)30-25-19-11-16-22-23(25)17-10-18-24(22)28-29-27/h4-9,11-16,19,24H,10,17-18H2,1-3H3 |
| InChIKey | SJQGRSYYHYIOKH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|