C26H31NOSi — CID 66696715
2-[tert-butyl(diphenyl)silyl]oxy-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 66696715) has the molecular formula C26H31NOSi and a molecular weight of 401.63 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 66696715 |
| Molecular Formula | C26H31NOSi |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | CC(C)(C)[Si](Oc1ccc2c(c1N)CCCC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31NOSi/c1-26(2,3)29(21-13-6-4-7-14-21,22-15-8-5-9-16-22)28-24-19-18-20-12-10-11-17-23(20)25(24)27/h4-9,13-16,18-19H,10-12,17,27H2,1-3H3 |
| InChIKey | WOBORWIICLOKAA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|