C30H31NOSi — CID 50993085
(2E)-2-[6-[tert-butyl(diphenyl)silyl]oxy-7-prop-2-enyl-2,3-dihydroinden-1-ylidene]acetonitrile (PubChem CID 50993085) has the molecular formula C30H31NOSi and a molecular weight of 449.67 g/mol. Its IUPAC name is (2E)-2-[6-[tert-butyl(diphenyl)silyl]oxy-7-prop-2-enyl-2,3-dihydroinden-1-ylidene]acetonitrile.
| Compound Name | (2E)-2-[6-[tert-butyl(diphenyl)silyl]oxy-7-prop-2-enyl-2,3-dihydroinden-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 50993085 |
| Molecular Formula | C30H31NOSi |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (2E)-2-[6-[tert-butyl(diphenyl)silyl]oxy-7-prop-2-enyl-2,3-dihydroinden-1-ylidene]acetonitrile |
| SMILES | C=CCc1c(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)ccc2c1/C(=C/C#N)CC2 |
| InChI | InChI=1S/C30H31NOSi/c1-5-12-27-28(20-19-23-17-18-24(21-22-31)29(23)27)32-33(30(2,3)4,25-13-8-6-9-14-25)26-15-10-7-11-16-26/h5-11,13-16,19-21H,1,12,17-18H2,2-4H3/b24-21+ |
| InChIKey | GLQRBWDKVCOUDC-DARPEHSRSA-N |
| XLogP | 6.21 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|