C33H42O4Si — CID 45258725
2-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxy-3,5-bis(prop-2-enyl)cyclohexa-2,5-dien-1-yl]acetaldehyde (PubChem CID 45258725) has the molecular formula C33H42O4Si and a molecular weight of 530.78 g/mol. Its IUPAC name is 2-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxy-3,5-bis(prop-2-enyl)cyclohexa-2,5-dien-1-yl]acetaldehyde.
| Compound Name | 2-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxy-3,5-bis(prop-2-enyl)cyclohexa-2,5-dien-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 45258725 |
| Molecular Formula | C33H42O4Si |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 2-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dimethoxy-3,5-bis(prop-2-enyl)cyclohexa-2,5-dien-1-yl]acetaldehyde |
| SMILES | C=CCC1=C(OC)C(CC=O)(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(OC)=C(CC=C)C1 |
| InChI | InChI=1S/C33H42O4Si/c1-8-16-26-24-27(17-9-2)31(36-7)33(22-23-34,30(26)35-6)25-37-38(32(3,4)5,28-18-12-10-13-19-28)29-20-14-11-15-21-29/h8-15,18-21,23H,1-2,16-17,22,24-25H2,3-7H3 |
| InChIKey | ZWABFODVAIFQEV-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|